C22H27NO7S — CID 87893615
(3E)-4-[4-[2-(4-methylsulfonyloxyphenyl)ethoxy]phenyl]-3-propoxyiminobutanoic acid (PubChem CID 87893615) has the molecular formula C22H27NO7S and a molecular weight of 449.53 g/mol. Its IUPAC name is (3E)-4-[4-[2-(4-methylsulfonyloxyphenyl)ethoxy]phenyl]-3-propoxyiminobutanoic acid.
| Compound Name | (3E)-4-[4-[2-(4-methylsulfonyloxyphenyl)ethoxy]phenyl]-3-propoxyiminobutanoic acid |
|---|---|
| PubChem CID | 87893615 |
| Molecular Formula | C22H27NO7S |
| Molecular Weight | 449.53 g/mol |
| Exact Mass | 449.15 |
| IUPAC Name | (3E)-4-[4-[2-(4-methylsulfonyloxyphenyl)ethoxy]phenyl]-3-propoxyiminobutanoic acid |
| SMILES | CCCO/N=C(/CC(=O)O)Cc1ccc(OCCc2ccc(OS(C)(=O)=O)cc2)cc1 |
| InChI | InChI=1S/C22H27NO7S/c1-3-13-29-23-19(16-22(24)25)15-18-6-8-20(9-7-18)28-14-12-17-4-10-21(11-5-17)30-31(2,26)27/h4-11H,3,12-16H2,1-2H3,(H,24,25)/b23-19+ |
| InChIKey | VZQYUYMHYDODTO-FCDQGJHFSA-N |
| XLogP | 3.45 |
| TPSA | 111.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.53 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|