C19H19NO6S2 — CID 54388556
[4-[2-[4-[(4-hydroxy-2-oxo-3H-1,3-thiazol-5-yl)methyl]phenoxy]ethyl]phenyl] methanesulfonate (PubChem CID 54388556) has the molecular formula C19H19NO6S2 and a molecular weight of 421.50 g/mol. Its IUPAC name is [4-[2-[4-[(4-hydroxy-2-oxo-3H-1,3-thiazol-5-yl)methyl]phenoxy]ethyl]phenyl] methanesulfonate.
| Compound Name | [4-[2-[4-[(4-hydroxy-2-oxo-3H-1,3-thiazol-5-yl)methyl]phenoxy]ethyl]phenyl] methanesulfonate |
|---|---|
| PubChem CID | 54388556 |
| Molecular Formula | C19H19NO6S2 |
| Molecular Weight | 421.50 g/mol |
| Exact Mass | 421.07 |
| IUPAC Name | [4-[2-[4-[(4-hydroxy-2-oxo-3H-1,3-thiazol-5-yl)methyl]phenoxy]ethyl]phenyl] methanesulfonate |
| SMILES | CS(=O)(=O)Oc1ccc(CCOc2ccc(Cc3sc(=O)[nH]c3O)cc2)cc1 |
| InChI | InChI=1S/C19H19NO6S2/c1-28(23,24)26-16-8-2-13(3-9-16)10-11-25-15-6-4-14(5-7-15)12-17-18(21)20-19(22)27-17/h2-9,21H,10-12H2,1H3,(H,20,22) |
| InChIKey | VEZKCTKSCMUSJM-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 105.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.50 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|