C20H18N2O5S — CID 54106589
5-[[4-[3-(1,3-benzoxazol-2-yloxy)propoxy]phenyl]methyl]-4-hydroxy-3H-1,3-thiazol-2-one (PubChem CID 54106589) has the molecular formula C20H18N2O5S and a molecular weight of 398.44 g/mol. Its IUPAC name is 5-[[4-[3-(1,3-benzoxazol-2-yloxy)propoxy]phenyl]methyl]-4-hydroxy-3H-1,3-thiazol-2-one.
| Compound Name | 5-[[4-[3-(1,3-benzoxazol-2-yloxy)propoxy]phenyl]methyl]-4-hydroxy-3H-1,3-thiazol-2-one |
|---|---|
| PubChem CID | 54106589 |
| Molecular Formula | C20H18N2O5S |
| Molecular Weight | 398.44 g/mol |
| Exact Mass | 398.09 |
| IUPAC Name | 5-[[4-[3-(1,3-benzoxazol-2-yloxy)propoxy]phenyl]methyl]-4-hydroxy-3H-1,3-thiazol-2-one |
| SMILES | O=c1[nH]c(O)c(Cc2ccc(OCCCOc3nc4ccccc4o3)cc2)s1 |
| InChI | InChI=1S/C20H18N2O5S/c23-18-17(28-19(24)22-18)12-13-6-8-14(9-7-13)25-10-3-11-26-20-21-15-4-1-2-5-16(15)27-20/h1-2,4-9,23H,3,10-12H2,(H,22,24) |
| InChIKey | NEEJHAZIALYMBA-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 97.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.44 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|