C16H21NO3S — CID 54287264
5-[(4-hexoxyphenyl)methyl]-4-hydroxy-3H-1,3-thiazol-2-one (PubChem CID 54287264) has the molecular formula C16H21NO3S and a molecular weight of 307.42 g/mol. Its IUPAC name is 5-[(4-hexoxyphenyl)methyl]-4-hydroxy-3H-1,3-thiazol-2-one.
| Compound Name | 5-[(4-hexoxyphenyl)methyl]-4-hydroxy-3H-1,3-thiazol-2-one |
|---|---|
| PubChem CID | 54287264 |
| Molecular Formula | C16H21NO3S |
| Molecular Weight | 307.42 g/mol |
| Exact Mass | 307.12 |
| IUPAC Name | 5-[(4-hexoxyphenyl)methyl]-4-hydroxy-3H-1,3-thiazol-2-one |
| SMILES | CCCCCCOc1ccc(Cc2sc(=O)[nH]c2O)cc1 |
| InChI | InChI=1S/C16H21NO3S/c1-2-3-4-5-10-20-13-8-6-12(7-9-13)11-14-15(18)17-16(19)21-14/h6-9,18H,2-5,10-11H2,1H3,(H,17,19) |
| InChIKey | RVAGSOSEWWTFPK-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 62.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.42 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|