C29H30N2O4S — CID 91612828
2-(4-butoxyphenyl)-N-[3-[4-[(4-hydroxy-2-oxo-3H-1,3-thiazol-5-yl)methyl]phenyl]phenyl]propanamide (PubChem CID 91612828) has the molecular formula C29H30N2O4S and a molecular weight of 502.64 g/mol. Its IUPAC name is 2-(4-butoxyphenyl)-N-[3-[4-[(4-hydroxy-2-oxo-3H-1,3-thiazol-5-yl)methyl]phenyl]phenyl]propanamide.
| Compound Name | 2-(4-butoxyphenyl)-N-[3-[4-[(4-hydroxy-2-oxo-3H-1,3-thiazol-5-yl)methyl]phenyl]phenyl]propanamide |
|---|---|
| PubChem CID | 91612828 |
| Molecular Formula | C29H30N2O4S |
| Molecular Weight | 502.64 g/mol |
| Exact Mass | 502.19 |
| IUPAC Name | 2-(4-butoxyphenyl)-N-[3-[4-[(4-hydroxy-2-oxo-3H-1,3-thiazol-5-yl)methyl]phenyl]phenyl]propanamide |
| SMILES | CCCCOc1ccc(C(C)C(=O)Nc2cccc(-c3ccc(Cc4sc(=O)[nH]c4O)cc3)c2)cc1 |
| InChI | InChI=1S/C29H30N2O4S/c1-3-4-16-35-25-14-12-21(13-15-25)19(2)27(32)30-24-7-5-6-23(18-24)22-10-8-20(9-11-22)17-26-28(33)31-29(34)36-26/h5-15,18-19,33H,3-4,16-17H2,1-2H3,(H,30,32)(H,31,34) |
| InChIKey | ODTVQJWCBHBWGO-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 91.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.64 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|