C27H24N2O6S — CID 56985533
5-[[4-[2-[1-[4-(1,3-benzodioxol-5-yl)phenyl]ethenylamino]oxyethoxy]phenyl]methyl]-4-hydroxy-3H-1,3-thiazol-2-one (PubChem CID 56985533) has the molecular formula C27H24N2O6S and a molecular weight of 504.56 g/mol. Its IUPAC name is 5-[[4-[2-[1-[4-(1,3-benzodioxol-5-yl)phenyl]ethenylamino]oxyethoxy]phenyl]methyl]-4-hydroxy-3H-1,3-thiazol-2-one.
| Compound Name | 5-[[4-[2-[1-[4-(1,3-benzodioxol-5-yl)phenyl]ethenylamino]oxyethoxy]phenyl]methyl]-4-hydroxy-3H-1,3-thiazol-2-one |
|---|---|
| PubChem CID | 56985533 |
| Molecular Formula | C27H24N2O6S |
| Molecular Weight | 504.56 g/mol |
| Exact Mass | 504.14 |
| IUPAC Name | 5-[[4-[2-[1-[4-(1,3-benzodioxol-5-yl)phenyl]ethenylamino]oxyethoxy]phenyl]methyl]-4-hydroxy-3H-1,3-thiazol-2-one |
| SMILES | C=C(NOCCOc1ccc(Cc2sc(=O)[nH]c2O)cc1)c1ccc(-c2ccc3c(c2)OCO3)cc1 |
| InChI | InChI=1S/C27H24N2O6S/c1-17(19-4-6-20(7-5-19)21-8-11-23-24(15-21)34-16-33-23)29-35-13-12-32-22-9-2-18(3-10-22)14-25-26(30)28-27(31)36-25/h2-11,15,29-30H,1,12-14,16H2,(H,28,31) |
| InChIKey | ULYIXLANEWORMT-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 102.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.56 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|