C24H24N4O4S — CID 57105498
4-hydroxy-5-[[4-[2-[1-(1-methyl-2-phenylimidazol-4-yl)ethenylamino]oxyethoxy]phenyl]methyl]-3H-1,3-thiazol-2-one (PubChem CID 57105498) has the molecular formula C24H24N4O4S and a molecular weight of 464.55 g/mol. Its IUPAC name is 4-hydroxy-5-[[4-[2-[1-(1-methyl-2-phenylimidazol-4-yl)ethenylamino]oxyethoxy]phenyl]methyl]-3H-1,3-thiazol-2-one.
| Compound Name | 4-hydroxy-5-[[4-[2-[1-(1-methyl-2-phenylimidazol-4-yl)ethenylamino]oxyethoxy]phenyl]methyl]-3H-1,3-thiazol-2-one |
|---|---|
| PubChem CID | 57105498 |
| Molecular Formula | C24H24N4O4S |
| Molecular Weight | 464.55 g/mol |
| Exact Mass | 464.15 |
| IUPAC Name | 4-hydroxy-5-[[4-[2-[1-(1-methyl-2-phenylimidazol-4-yl)ethenylamino]oxyethoxy]phenyl]methyl]-3H-1,3-thiazol-2-one |
| SMILES | C=C(NOCCOc1ccc(Cc2sc(=O)[nH]c2O)cc1)c1cn(C)c(-c2ccccc2)n1 |
| InChI | InChI=1S/C24H24N4O4S/c1-16(20-15-28(2)22(25-20)18-6-4-3-5-7-18)27-32-13-12-31-19-10-8-17(9-11-19)14-21-23(29)26-24(30)33-21/h3-11,15,27,29H,1,12-14H2,2H3,(H,26,30) |
| InChIKey | ONXWPBDMLYZQCM-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 101.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.55 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|