C39H35N3O5S — CID 56978756
4-hydroxy-5-[[4-[2-[1-(6-methoxy-3-pyridinyl)ethenylamino]oxyethoxy]phenyl]methyl]-3-trityl-1,3-thiazol-2-one (PubChem CID 56978756) has the molecular formula C39H35N3O5S and a molecular weight of 657.79 g/mol. Its IUPAC name is 4-hydroxy-5-[[4-[2-[1-(6-methoxy-3-pyridinyl)ethenylamino]oxyethoxy]phenyl]methyl]-3-trityl-1,3-thiazol-2-one.
| Compound Name | 4-hydroxy-5-[[4-[2-[1-(6-methoxy-3-pyridinyl)ethenylamino]oxyethoxy]phenyl]methyl]-3-trityl-1,3-thiazol-2-one |
|---|---|
| PubChem CID | 56978756 |
| Molecular Formula | C39H35N3O5S |
| Molecular Weight | 657.79 g/mol |
| Exact Mass | 657.23 |
| IUPAC Name | 4-hydroxy-5-[[4-[2-[1-(6-methoxy-3-pyridinyl)ethenylamino]oxyethoxy]phenyl]methyl]-3-trityl-1,3-thiazol-2-one |
| SMILES | C=C(NOCCOc1ccc(Cc2sc(=O)n(C(c3ccccc3)(c3ccccc3)c3ccccc3)c2O)cc1)c1ccc(OC)nc1 |
| InChI | InChI=1S/C39H35N3O5S/c1-28(30-20-23-36(45-2)40-27-30)41-47-25-24-46-34-21-18-29(19-22-34)26-35-37(43)42(38(44)48-35)39(31-12-6-3-7-13-31,32-14-8-4-9-15-32)33-16-10-5-11-17-33/h3-23,27,41,43H,1,24-26H2,2H3 |
| InChIKey | GENRGFFBRJBFQD-UHFFFAOYSA-N |
| XLogP | 7.02 |
| TPSA | 94.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.79 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|