C38H32N4O4S — CID 54565152
4-hydroxy-5-[[4-[(5-methoxy-3-methylimidazo[4,5-b]pyridin-2-yl)methoxy]phenyl]methyl]-3-trityl-1,3-thiazol-2-one (PubChem CID 54565152) has the molecular formula C38H32N4O4S and a molecular weight of 640.76 g/mol. Its IUPAC name is 4-hydroxy-5-[[4-[(5-methoxy-3-methylimidazo[4,5-b]pyridin-2-yl)methoxy]phenyl]methyl]-3-trityl-1,3-thiazol-2-one.
| Compound Name | 4-hydroxy-5-[[4-[(5-methoxy-3-methylimidazo[4,5-b]pyridin-2-yl)methoxy]phenyl]methyl]-3-trityl-1,3-thiazol-2-one |
|---|---|
| PubChem CID | 54565152 |
| Molecular Formula | C38H32N4O4S |
| Molecular Weight | 640.76 g/mol |
| Exact Mass | 640.21 |
| IUPAC Name | 4-hydroxy-5-[[4-[(5-methoxy-3-methylimidazo[4,5-b]pyridin-2-yl)methoxy]phenyl]methyl]-3-trityl-1,3-thiazol-2-one |
| SMILES | COc1ccc2nc(COc3ccc(Cc4sc(=O)n(C(c5ccccc5)(c5ccccc5)c5ccccc5)c4O)cc3)n(C)c2n1 |
| InChI | InChI=1S/C38H32N4O4S/c1-41-33(39-31-22-23-34(45-2)40-35(31)41)25-46-30-20-18-26(19-21-30)24-32-36(43)42(37(44)47-32)38(27-12-6-3-7-13-27,28-14-8-4-9-15-28)29-16-10-5-11-17-29/h3-23,43H,24-25H2,1-2H3 |
| InChIKey | ZTHGPWIUPBRIKL-UHFFFAOYSA-N |
| XLogP | 6.92 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.76 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|