C36H29N5O3S — CID 23298366
5-[[4-[(9-methylpurin-8-yl)methoxy]phenyl]methyl]-3-trityl-1,3-thiazolidine-2,4-dione (PubChem CID 23298366) has the molecular formula C36H29N5O3S and a molecular weight of 611.73 g/mol. Its IUPAC name is 5-[[4-[(9-methylpurin-8-yl)methoxy]phenyl]methyl]-3-trityl-1,3-thiazolidine-2,4-dione.
| Compound Name | 5-[[4-[(9-methylpurin-8-yl)methoxy]phenyl]methyl]-3-trityl-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 23298366 |
| Molecular Formula | C36H29N5O3S |
| Molecular Weight | 611.73 g/mol |
| Exact Mass | 611.20 |
| IUPAC Name | 5-[[4-[(9-methylpurin-8-yl)methoxy]phenyl]methyl]-3-trityl-1,3-thiazolidine-2,4-dione |
| SMILES | Cn1c(COc2ccc(CC3SC(=O)N(C(c4ccccc4)(c4ccccc4)c4ccccc4)C3=O)cc2)nc2cncnc21 |
| InChI | InChI=1S/C36H29N5O3S/c1-40-32(39-30-22-37-24-38-33(30)40)23-44-29-19-17-25(18-20-29)21-31-34(42)41(35(43)45-31)36(26-11-5-2-6-12-26,27-13-7-3-8-14-27)28-15-9-4-10-16-28/h2-20,22,24,31H,21,23H2,1H3 |
| InChIKey | SFITYQWTSLLHMY-UHFFFAOYSA-N |
| XLogP | 6.54 |
| TPSA | 90.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.73 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|