C38H31N3O3S — CID 19957314
5-[[4-[(1-methylimidazo[4,5-b]pyridin-2-yl)methoxy]phenyl]methyl]-3-tritylthiolane-2,4-dione (PubChem CID 19957314) has the molecular formula C38H31N3O3S and a molecular weight of 609.75 g/mol. Its IUPAC name is 5-[[4-[(1-methylimidazo[4,5-b]pyridin-2-yl)methoxy]phenyl]methyl]-3-tritylthiolane-2,4-dione.
| Compound Name | 5-[[4-[(1-methylimidazo[4,5-b]pyridin-2-yl)methoxy]phenyl]methyl]-3-tritylthiolane-2,4-dione |
|---|---|
| PubChem CID | 19957314 |
| Molecular Formula | C38H31N3O3S |
| Molecular Weight | 609.75 g/mol |
| Exact Mass | 609.21 |
| IUPAC Name | 5-[[4-[(1-methylimidazo[4,5-b]pyridin-2-yl)methoxy]phenyl]methyl]-3-tritylthiolane-2,4-dione |
| SMILES | Cn1c(COc2ccc(CC3SC(=O)C(C(c4ccccc4)(c4ccccc4)c4ccccc4)C3=O)cc2)nc2ncccc21 |
| InChI | InChI=1S/C38H31N3O3S/c1-41-31-18-11-23-39-36(31)40-33(41)25-44-30-21-19-26(20-22-30)24-32-35(42)34(37(43)45-32)38(27-12-5-2-6-13-27,28-14-7-3-8-15-28)29-16-9-4-10-17-29/h2-23,32,34H,24-25H2,1H3 |
| InChIKey | JRCJFJFTDUBYGW-UHFFFAOYSA-N |
| XLogP | 6.95 |
| TPSA | 74.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.75 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|