C21H20N2O4S — CID 90325044
5-deuterio-5-[[4-[(6-methoxy-1-methylbenzimidazol-2-yl)methoxy]phenyl]methyl]thiolane-2,4-dione (PubChem CID 90325044) has the molecular formula C21H20N2O4S and a molecular weight of 397.47 g/mol. Its IUPAC name is 5-deuterio-5-[[4-[(6-methoxy-1-methylbenzimidazol-2-yl)methoxy]phenyl]methyl]thiolane-2,4-dione.
| Compound Name | 5-deuterio-5-[[4-[(6-methoxy-1-methylbenzimidazol-2-yl)methoxy]phenyl]methyl]thiolane-2,4-dione |
|---|---|
| PubChem CID | 90325044 |
| Molecular Formula | C21H20N2O4S |
| Molecular Weight | 397.47 g/mol |
| Exact Mass | 397.12 |
| IUPAC Name | 5-deuterio-5-[[4-[(6-methoxy-1-methylbenzimidazol-2-yl)methoxy]phenyl]methyl]thiolane-2,4-dione |
| SMILES | [2H]C1(Cc2ccc(OCc3nc4ccc(OC)cc4n3C)cc2)SC(=O)CC1=O |
| InChI | InChI=1S/C21H20N2O4S/c1-23-17-10-15(26-2)7-8-16(17)22-20(23)12-27-14-5-3-13(4-6-14)9-19-18(24)11-21(25)28-19/h3-8,10,19H,9,11-12H2,1-2H3/i19D |
| InChIKey | YYEDVHAFUOIDHX-YUIGOLOMSA-N |
| XLogP | 3.30 |
| TPSA | 70.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.47 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|