C40H36N4O4S — CID 54206680
4-hydroxy-5-[[4-[(3-methyl-5-propan-2-yloxyimidazo[4,5-b]pyridin-2-yl)methoxy]phenyl]methyl]-3-trityl-1,3-thiazol-2-one (PubChem CID 54206680) has the molecular formula C40H36N4O4S and a molecular weight of 668.82 g/mol. Its IUPAC name is 4-hydroxy-5-[[4-[(3-methyl-5-propan-2-yloxyimidazo[4,5-b]pyridin-2-yl)methoxy]phenyl]methyl]-3-trityl-1,3-thiazol-2-one.
| Compound Name | 4-hydroxy-5-[[4-[(3-methyl-5-propan-2-yloxyimidazo[4,5-b]pyridin-2-yl)methoxy]phenyl]methyl]-3-trityl-1,3-thiazol-2-one |
|---|---|
| PubChem CID | 54206680 |
| Molecular Formula | C40H36N4O4S |
| Molecular Weight | 668.82 g/mol |
| Exact Mass | 668.25 |
| IUPAC Name | 4-hydroxy-5-[[4-[(3-methyl-5-propan-2-yloxyimidazo[4,5-b]pyridin-2-yl)methoxy]phenyl]methyl]-3-trityl-1,3-thiazol-2-one |
| SMILES | CC(C)Oc1ccc2nc(COc3ccc(Cc4sc(=O)n(C(c5ccccc5)(c5ccccc5)c5ccccc5)c4O)cc3)n(C)c2n1 |
| InChI | InChI=1S/C40H36N4O4S/c1-27(2)48-36-24-23-33-37(42-36)43(3)35(41-33)26-47-32-21-19-28(20-22-32)25-34-38(45)44(39(46)49-34)40(29-13-7-4-8-14-29,30-15-9-5-10-16-30)31-17-11-6-12-18-31/h4-24,27,45H,25-26H2,1-3H3 |
| InChIKey | PSZAYPFDZYHDKX-UHFFFAOYSA-N |
| XLogP | 7.69 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.82 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|