C37H30N4O3S — CID 54517983
4-hydroxy-5-[[4-[1-(3H-imidazo[4,5-c]pyridin-2-yl)ethoxy]phenyl]methyl]-3-trityl-1,3-thiazol-2-one (PubChem CID 54517983) has the molecular formula C37H30N4O3S and a molecular weight of 610.74 g/mol. Its IUPAC name is 4-hydroxy-5-[[4-[1-(3H-imidazo[4,5-c]pyridin-2-yl)ethoxy]phenyl]methyl]-3-trityl-1,3-thiazol-2-one.
| Compound Name | 4-hydroxy-5-[[4-[1-(3H-imidazo[4,5-c]pyridin-2-yl)ethoxy]phenyl]methyl]-3-trityl-1,3-thiazol-2-one |
|---|---|
| PubChem CID | 54517983 |
| Molecular Formula | C37H30N4O3S |
| Molecular Weight | 610.74 g/mol |
| Exact Mass | 610.20 |
| IUPAC Name | 4-hydroxy-5-[[4-[1-(3H-imidazo[4,5-c]pyridin-2-yl)ethoxy]phenyl]methyl]-3-trityl-1,3-thiazol-2-one |
| SMILES | CC(Oc1ccc(Cc2sc(=O)n(C(c3ccccc3)(c3ccccc3)c3ccccc3)c2O)cc1)c1nc2ccncc2[nH]1 |
| InChI | InChI=1S/C37H30N4O3S/c1-25(34-39-31-21-22-38-24-32(31)40-34)44-30-19-17-26(18-20-30)23-33-35(42)41(36(43)45-33)37(27-11-5-2-6-12-27,28-13-7-3-8-14-28)29-15-9-4-10-16-29/h2-22,24-25,42H,23H2,1H3,(H,39,40) |
| InChIKey | YNSZIDKHAVONHO-UHFFFAOYSA-N |
| XLogP | 7.46 |
| TPSA | 93.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.74 |
| LogP ≤ 5 | 7.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|