C20H22N2O2S2 — CID 18184923
2-methyl-3-[4-[1-(6-methylsulfanyl-1H-benzimidazol-2-yl)ethoxy]phenyl]propanethioic S-acid (PubChem CID 18184923) has the molecular formula C20H22N2O2S2 and a molecular weight of 386.54 g/mol. Its IUPAC name is 2-methyl-3-[4-[1-(6-methylsulfanyl-1H-benzimidazol-2-yl)ethoxy]phenyl]propanethioic S-acid.
| Compound Name | 2-methyl-3-[4-[1-(6-methylsulfanyl-1H-benzimidazol-2-yl)ethoxy]phenyl]propanethioic S-acid |
|---|---|
| PubChem CID | 18184923 |
| Molecular Formula | C20H22N2O2S2 |
| Molecular Weight | 386.54 g/mol |
| Exact Mass | 386.11 |
| IUPAC Name | 2-methyl-3-[4-[1-(6-methylsulfanyl-1H-benzimidazol-2-yl)ethoxy]phenyl]propanethioic S-acid |
| SMILES | CSc1ccc2nc(C(C)Oc3ccc(CC(C)C(=O)S)cc3)[nH]c2c1 |
| InChI | InChI=1S/C20H22N2O2S2/c1-12(20(23)25)10-14-4-6-15(7-5-14)24-13(2)19-21-17-9-8-16(26-3)11-18(17)22-19/h4-9,11-13H,10H2,1-3H3,(H,21,22)(H,23,25) |
| InChIKey | YDEZSBSTAZYANE-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.54 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|