C18H20N2O — CID 46264663
2-[1-(3,4-dimethylphenoxy)ethyl]-6-methyl-1H-benzimidazole (PubChem CID 46264663) has the molecular formula C18H20N2O and a molecular weight of 280.37 g/mol. Its IUPAC name is 2-[1-(3,4-dimethylphenoxy)ethyl]-6-methyl-1H-benzimidazole.
| Compound Name | 2-[1-(3,4-dimethylphenoxy)ethyl]-6-methyl-1H-benzimidazole |
|---|---|
| PubChem CID | 46264663 |
| Molecular Formula | C18H20N2O |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.16 |
| IUPAC Name | 2-[1-(3,4-dimethylphenoxy)ethyl]-6-methyl-1H-benzimidazole |
| SMILES | Cc1ccc2nc(C(C)Oc3ccc(C)c(C)c3)[nH]c2c1 |
| InChI | InChI=1S/C18H20N2O/c1-11-5-8-16-17(9-11)20-18(19-16)14(4)21-15-7-6-12(2)13(3)10-15/h5-10,14H,1-4H3,(H,19,20) |
| InChIKey | OXSHRETWCMNQBI-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 37.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |