C20H22N2O3S — CID 18184920
3-[4-[1-(6-methoxy-1H-benzimidazol-2-yl)ethoxy]phenyl]-2-methylpropanethioic S-acid (PubChem CID 18184920) has the molecular formula C20H22N2O3S and a molecular weight of 370.47 g/mol. Its IUPAC name is 3-[4-[1-(6-methoxy-1H-benzimidazol-2-yl)ethoxy]phenyl]-2-methylpropanethioic S-acid.
| Compound Name | 3-[4-[1-(6-methoxy-1H-benzimidazol-2-yl)ethoxy]phenyl]-2-methylpropanethioic S-acid |
|---|---|
| PubChem CID | 18184920 |
| Molecular Formula | C20H22N2O3S |
| Molecular Weight | 370.47 g/mol |
| Exact Mass | 370.14 |
| IUPAC Name | 3-[4-[1-(6-methoxy-1H-benzimidazol-2-yl)ethoxy]phenyl]-2-methylpropanethioic S-acid |
| SMILES | COc1ccc2nc(C(C)Oc3ccc(CC(C)C(=O)S)cc3)[nH]c2c1 |
| InChI | InChI=1S/C20H22N2O3S/c1-12(20(23)26)10-14-4-6-15(7-5-14)25-13(2)19-21-17-9-8-16(24-3)11-18(17)22-19/h4-9,11-13H,10H2,1-3H3,(H,21,22)(H,23,26) |
| InChIKey | ULXMXTNOAYJOKU-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 64.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.47 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|