C16H16N2O3 — CID 89433863
(6-methoxy-1H-benzimidazol-2-yl)-(4-methoxyphenyl)methanol (PubChem CID 89433863) has the molecular formula C16H16N2O3 and a molecular weight of 284.32 g/mol. Its IUPAC name is (6-methoxy-1H-benzimidazol-2-yl)-(4-methoxyphenyl)methanol.
| Compound Name | (6-methoxy-1H-benzimidazol-2-yl)-(4-methoxyphenyl)methanol |
|---|---|
| PubChem CID | 89433863 |
| Molecular Formula | C16H16N2O3 |
| Molecular Weight | 284.32 g/mol |
| Exact Mass | 284.12 |
| IUPAC Name | (6-methoxy-1H-benzimidazol-2-yl)-(4-methoxyphenyl)methanol |
| SMILES | COc1ccc(C(O)c2nc3ccc(OC)cc3[nH]2)cc1 |
| InChI | InChI=1S/C16H16N2O3/c1-20-11-5-3-10(4-6-11)15(19)16-17-13-8-7-12(21-2)9-14(13)18-16/h3-9,15,19H,1-2H3,(H,17,18) |
| InChIKey | JDNBVLFDOZUOFK-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 67.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.32 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |