C18H16N4O4 — CID 21026309
2-[1,2-dihydroxy-2-(6-methoxy-1H-benzimidazol-2-yl)ethyl]-3H-benzimidazole-5-carbaldehyde (PubChem CID 21026309) has the molecular formula C18H16N4O4 and a molecular weight of 352.35 g/mol. Its IUPAC name is 2-[1,2-dihydroxy-2-(6-methoxy-1H-benzimidazol-2-yl)ethyl]-3H-benzimidazole-5-carbaldehyde.
| Compound Name | 2-[1,2-dihydroxy-2-(6-methoxy-1H-benzimidazol-2-yl)ethyl]-3H-benzimidazole-5-carbaldehyde |
|---|---|
| PubChem CID | 21026309 |
| Molecular Formula | C18H16N4O4 |
| Molecular Weight | 352.35 g/mol |
| Exact Mass | 352.12 |
| IUPAC Name | 2-[1,2-dihydroxy-2-(6-methoxy-1H-benzimidazol-2-yl)ethyl]-3H-benzimidazole-5-carbaldehyde |
| SMILES | COc1ccc2nc(C(O)C(O)c3nc4ccc(C=O)cc4[nH]3)[nH]c2c1 |
| InChI | InChI=1S/C18H16N4O4/c1-26-10-3-5-12-14(7-10)22-18(20-12)16(25)15(24)17-19-11-4-2-9(8-23)6-13(11)21-17/h2-8,15-16,24-25H,1H3,(H,19,21)(H,20,22) |
| InChIKey | LNHILHRACMWOMT-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 124.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.35 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|