C25H24N2O4 — CID 20673646
4-[4-[2-(1,3-benzodioxol-5-yloxy)ethoxy]-3-prop-2-enylphenyl]benzenecarboximidamide (PubChem CID 20673646) has the molecular formula C25H24N2O4 and a molecular weight of 416.48 g/mol. Its IUPAC name is 4-[4-[2-(1,3-benzodioxol-5-yloxy)ethoxy]-3-prop-2-enylphenyl]benzenecarboximidamide.
| Compound Name | 4-[4-[2-(1,3-benzodioxol-5-yloxy)ethoxy]-3-prop-2-enylphenyl]benzenecarboximidamide |
|---|---|
| PubChem CID | 20673646 |
| Molecular Formula | C25H24N2O4 |
| Molecular Weight | 416.48 g/mol |
| Exact Mass | 416.17 |
| IUPAC Name | 4-[4-[2-(1,3-benzodioxol-5-yloxy)ethoxy]-3-prop-2-enylphenyl]benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(-c2ccc(OCCOc3ccc4c(c3)OCO4)c(CC=C)c2)cc1 |
| InChI | InChI=1S/C25H24N2O4/c1-2-3-20-14-19(17-4-6-18(7-5-17)25(26)27)8-10-22(20)29-13-12-28-21-9-11-23-24(15-21)31-16-30-23/h2,4-11,14-15H,1,3,12-13,16H2,(H3,26,27) |
| InChIKey | HCRHUKXUZZYGQJ-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.48 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|