C26H34N2O6S — CID 57144439
5-[[4-[3-[[1-(2,5-dimethoxy-3,4,6-trimethylphenyl)-1-hydroxyethyl]amino]propoxy]phenyl]methyl]-4-hydroxy-3H-1,3-thiazol-2-one (PubChem CID 57144439) has the molecular formula C26H34N2O6S and a molecular weight of 502.63 g/mol. Its IUPAC name is 5-[[4-[3-[[1-(2,5-dimethoxy-3,4,6-trimethylphenyl)-1-hydroxyethyl]amino]propoxy]phenyl]methyl]-4-hydroxy-3H-1,3-thiazol-2-one.
| Compound Name | 5-[[4-[3-[[1-(2,5-dimethoxy-3,4,6-trimethylphenyl)-1-hydroxyethyl]amino]propoxy]phenyl]methyl]-4-hydroxy-3H-1,3-thiazol-2-one |
|---|---|
| PubChem CID | 57144439 |
| Molecular Formula | C26H34N2O6S |
| Molecular Weight | 502.63 g/mol |
| Exact Mass | 502.21 |
| IUPAC Name | 5-[[4-[3-[[1-(2,5-dimethoxy-3,4,6-trimethylphenyl)-1-hydroxyethyl]amino]propoxy]phenyl]methyl]-4-hydroxy-3H-1,3-thiazol-2-one |
| SMILES | COc1c(C)c(C)c(OC)c(C(C)(O)NCCCOc2ccc(Cc3sc(=O)[nH]c3O)cc2)c1C |
| InChI | InChI=1S/C26H34N2O6S/c1-15-16(2)23(33-6)21(17(3)22(15)32-5)26(4,31)27-12-7-13-34-19-10-8-18(9-11-19)14-20-24(29)28-25(30)35-20/h8-11,27,29,31H,7,12-14H2,1-6H3,(H,28,30) |
| InChIKey | JZCANFJOBBLCEC-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 113.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.63 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|