C24H33NO4 — CID 173230831
tert-butyl N-[4-[2-[4-(1-propoxyethyl)phenoxy]ethyl]phenyl]carbamate (PubChem CID 173230831) has the molecular formula C24H33NO4 and a molecular weight of 399.53 g/mol. Its IUPAC name is tert-butyl N-[4-[2-[4-(1-propoxyethyl)phenoxy]ethyl]phenyl]carbamate.
| Compound Name | tert-butyl N-[4-[2-[4-(1-propoxyethyl)phenoxy]ethyl]phenyl]carbamate |
|---|---|
| PubChem CID | 173230831 |
| Molecular Formula | C24H33NO4 |
| Molecular Weight | 399.53 g/mol |
| Exact Mass | 399.24 |
| IUPAC Name | tert-butyl N-[4-[2-[4-(1-propoxyethyl)phenoxy]ethyl]phenyl]carbamate |
| SMILES | CCCOC(C)c1ccc(OCCc2ccc(NC(=O)OC(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C24H33NO4/c1-6-16-27-18(2)20-9-13-22(14-10-20)28-17-15-19-7-11-21(12-8-19)25-23(26)29-24(3,4)5/h7-14,18H,6,15-17H2,1-5H3,(H,25,26) |
| InChIKey | CNWRTTJHLONMTA-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.53 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |