C28H22FN3O6 — CID 11260840
N-[4-[(2,4-dinitrophenoxy)methyl]phenyl]-2-(3-fluoro-4-phenylphenyl)propanamide (PubChem CID 11260840) has the molecular formula C28H22FN3O6 and a molecular weight of 515.50 g/mol. Its IUPAC name is N-[4-[(2,4-dinitrophenoxy)methyl]phenyl]-2-(3-fluoro-4-phenylphenyl)propanamide.
| Compound Name | N-[4-[(2,4-dinitrophenoxy)methyl]phenyl]-2-(3-fluoro-4-phenylphenyl)propanamide |
|---|---|
| PubChem CID | 11260840 |
| Molecular Formula | C28H22FN3O6 |
| Molecular Weight | 515.50 g/mol |
| Exact Mass | 515.15 |
| IUPAC Name | N-[4-[(2,4-dinitrophenoxy)methyl]phenyl]-2-(3-fluoro-4-phenylphenyl)propanamide |
| SMILES | CC(C(=O)Nc1ccc(COc2ccc([N+](=O)[O-])cc2[N+](=O)[O-])cc1)c1ccc(-c2ccccc2)c(F)c1 |
| InChI | InChI=1S/C28H22FN3O6/c1-18(21-9-13-24(25(29)15-21)20-5-3-2-4-6-20)28(33)30-22-10-7-19(8-11-22)17-38-27-14-12-23(31(34)35)16-26(27)32(36)37/h2-16,18H,17H2,1H3,(H,30,33) |
| InChIKey | RKZWYWVKRNDPPC-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 124.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.50 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|