C15H20FNO3 — CID 162385912
tert-butyl 3-(4-fluorophenoxy)-3-methylazetidine-1-carboxylate (PubChem CID 162385912) has the molecular formula C15H20FNO3 and a molecular weight of 281.33 g/mol. Its IUPAC name is tert-butyl 3-(4-fluorophenoxy)-3-methylazetidine-1-carboxylate.
| Compound Name | tert-butyl 3-(4-fluorophenoxy)-3-methylazetidine-1-carboxylate |
|---|---|
| PubChem CID | 162385912 |
| Molecular Formula | C15H20FNO3 |
| Molecular Weight | 281.33 g/mol |
| Exact Mass | 281.14 |
| IUPAC Name | tert-butyl 3-(4-fluorophenoxy)-3-methylazetidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC(C)(Oc2ccc(F)cc2)C1 |
| InChI | InChI=1S/C15H20FNO3/c1-14(2,3)20-13(18)17-9-15(4,10-17)19-12-7-5-11(16)6-8-12/h5-8H,9-10H2,1-4H3 |
| InChIKey | ATFMPHJUVDPNDZ-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.33 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |