C16H19FN2O3 — CID 166158070
tert-butyl 3-(5-fluoro-1H-indol-3-yl)-3-hydroxyazetidine-1-carboxylate (PubChem CID 166158070) has the molecular formula C16H19FN2O3 and a molecular weight of 306.34 g/mol. Its IUPAC name is tert-butyl 3-(5-fluoro-1H-indol-3-yl)-3-hydroxyazetidine-1-carboxylate.
| Compound Name | tert-butyl 3-(5-fluoro-1H-indol-3-yl)-3-hydroxyazetidine-1-carboxylate |
|---|---|
| PubChem CID | 166158070 |
| Molecular Formula | C16H19FN2O3 |
| Molecular Weight | 306.34 g/mol |
| Exact Mass | 306.14 |
| IUPAC Name | tert-butyl 3-(5-fluoro-1H-indol-3-yl)-3-hydroxyazetidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC(O)(c2c[nH]c3ccc(F)cc23)C1 |
| InChI | InChI=1S/C16H19FN2O3/c1-15(2,3)22-14(20)19-8-16(21,9-19)12-7-18-13-5-4-10(17)6-11(12)13/h4-7,18,21H,8-9H2,1-3H3 |
| InChIKey | ZJJSGGLGVBBQIE-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 65.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.34 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |