C11H20ClF3N2O2 — CID 91828194
tert-butyl 4-amino-4-(trifluoromethyl)piperidine-1-carboxylate;hydrochloride (PubChem CID 91828194) has the molecular formula C11H20ClF3N2O2 and a molecular weight of 304.74 g/mol. Its IUPAC name is tert-butyl 4-amino-4-(trifluoromethyl)piperidine-1-carboxylate;hydrochloride.
| Compound Name | tert-butyl 4-amino-4-(trifluoromethyl)piperidine-1-carboxylate;hydrochloride |
|---|---|
| PubChem CID | 91828194 |
| Molecular Formula | C11H20ClF3N2O2 |
| Molecular Weight | 304.74 g/mol |
| Exact Mass | 304.12 |
| IUPAC Name | tert-butyl 4-amino-4-(trifluoromethyl)piperidine-1-carboxylate;hydrochloride |
| SMILES | CC(C)(C)OC(=O)N1CCC(N)(C(F)(F)F)CC1.Cl |
| InChI | InChI=1S/C11H19F3N2O2.ClH/c1-9(2,3)18-8(17)16-6-4-10(15,5-7-16)11(12,13)14;/h4-7,15H2,1-3H3;1H |
| InChIKey | ZFIAHPZJJRVMJZ-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.74 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |