C13H23F3N2O2 — CID 134818881
tert-butyl 4-(dimethylamino)-4-(trifluoromethyl)piperidine-1-carboxylate (PubChem CID 134818881) has the molecular formula C13H23F3N2O2 and a molecular weight of 296.33 g/mol. Its IUPAC name is tert-butyl 4-(dimethylamino)-4-(trifluoromethyl)piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-(dimethylamino)-4-(trifluoromethyl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 134818881 |
| Molecular Formula | C13H23F3N2O2 |
| Molecular Weight | 296.33 g/mol |
| Exact Mass | 296.17 |
| IUPAC Name | tert-butyl 4-(dimethylamino)-4-(trifluoromethyl)piperidine-1-carboxylate |
| SMILES | CN(C)C1(C(F)(F)F)CCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C13H23F3N2O2/c1-11(2,3)20-10(19)18-8-6-12(7-9-18,17(4)5)13(14,15)16/h6-9H2,1-5H3 |
| InChIKey | KVZIACMYHUTOLQ-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.33 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |