C17H32N2O5Si — CID 19918234
tert-butyl 4-[tert-butyl(dimethyl)silyl]oxy-2-[(E)-2-nitroethenyl]pyrrolidine-1-carboxylate (PubChem CID 19918234) has the molecular formula C17H32N2O5Si and a molecular weight of 372.54 g/mol. Its IUPAC name is tert-butyl 4-[tert-butyl(dimethyl)silyl]oxy-2-[(E)-2-nitroethenyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 4-[tert-butyl(dimethyl)silyl]oxy-2-[(E)-2-nitroethenyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 19918234 |
| Molecular Formula | C17H32N2O5Si |
| Molecular Weight | 372.54 g/mol |
| Exact Mass | 372.21 |
| IUPAC Name | tert-butyl 4-[tert-butyl(dimethyl)silyl]oxy-2-[(E)-2-nitroethenyl]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC(O[Si](C)(C)C(C)(C)C)CC1/C=C/[N+](=O)[O-] |
| InChI | InChI=1S/C17H32N2O5Si/c1-16(2,3)23-15(20)18-12-14(11-13(18)9-10-19(21)22)24-25(7,8)17(4,5)6/h9-10,13-14H,11-12H2,1-8H3/b10-9+ |
| InChIKey | SVQNTOYUWAKAMT-MDZDMXLPSA-N |
| XLogP | 4.18 |
| TPSA | 81.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.54 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|