C17H34N2O5Si — CID 67891429
tert-butyl (2R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-(2-nitroethyl)pyrrolidine-1-carboxylate (PubChem CID 67891429) has the molecular formula C17H34N2O5Si and a molecular weight of 374.55 g/mol. Its IUPAC name is tert-butyl (2R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-(2-nitroethyl)pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-(2-nitroethyl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 67891429 |
| Molecular Formula | C17H34N2O5Si |
| Molecular Weight | 374.55 g/mol |
| Exact Mass | 374.22 |
| IUPAC Name | tert-butyl (2R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-(2-nitroethyl)pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C[C@H](O[Si](C)(C)C(C)(C)C)C[C@H]1CC[N+](=O)[O-] |
| InChI | InChI=1S/C17H34N2O5Si/c1-16(2,3)23-15(20)18-12-14(11-13(18)9-10-19(21)22)24-25(7,8)17(4,5)6/h13-14H,9-12H2,1-8H3/t13-,14-/m1/s1 |
| InChIKey | CFHNNEOOIAFIQL-ZIAGYGMSSA-N |
| XLogP | 4.05 |
| TPSA | 81.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.55 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|