C18H36N2O6Si — CID 10573304
tert-butyl (2R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-[(2R)-2-hydroxy-3-nitropropyl]pyrrolidine-1-carboxylate (PubChem CID 10573304) has the molecular formula C18H36N2O6Si and a molecular weight of 404.58 g/mol. Its IUPAC name is tert-butyl (2R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-[(2R)-2-hydroxy-3-nitropropyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-[(2R)-2-hydroxy-3-nitropropyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 10573304 |
| Molecular Formula | C18H36N2O6Si |
| Molecular Weight | 404.58 g/mol |
| Exact Mass | 404.23 |
| IUPAC Name | tert-butyl (2R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-[(2R)-2-hydroxy-3-nitropropyl]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C[C@H](O[Si](C)(C)C(C)(C)C)C[C@H]1C[C@@H](O)C[N+](=O)[O-] |
| InChI | InChI=1S/C18H36N2O6Si/c1-17(2,3)25-16(22)19-12-15(26-27(7,8)18(4,5)6)10-13(19)9-14(21)11-20(23)24/h13-15,21H,9-12H2,1-8H3/t13-,14-,15-/m1/s1 |
| InChIKey | GUJXDBFSNSXWPC-RBSFLKMASA-N |
| XLogP | 3.41 |
| TPSA | 102.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.58 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|