C30H57NO12Si2 — CID 101195978
[(2R,3R,4S,5S)-3,4-diacetyloxy-5-[[(2R,3R,4S,5S)-5-(2-aminoethoxy)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]oxolan-2-yl]methoxy]oxolan-2-yl]methyl acetate (PubChem CID 101195978) has the molecular formula C30H57NO12Si2 and a molecular weight of 679.95 g/mol. Its IUPAC name is [(2R,3R,4S,5S)-3,4-diacetyloxy-5-[[(2R,3R,4S,5S)-5-(2-aminoethoxy)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]oxolan-2-yl]methoxy]oxolan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S,5S)-3,4-diacetyloxy-5-[[(2R,3R,4S,5S)-5-(2-aminoethoxy)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]oxolan-2-yl]methoxy]oxolan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 101195978 |
| Molecular Formula | C30H57NO12Si2 |
| Molecular Weight | 679.95 g/mol |
| Exact Mass | 679.34 |
| IUPAC Name | [(2R,3R,4S,5S)-3,4-diacetyloxy-5-[[(2R,3R,4S,5S)-5-(2-aminoethoxy)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]oxolan-2-yl]methoxy]oxolan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@H](OC[C@H]2O[C@H](OCCN)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]2O[Si](C)(C)C(C)(C)C)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C30H57NO12Si2/c1-18(32)36-16-21-23(38-19(2)33)25(39-20(3)34)27(40-21)37-17-22-24(42-44(10,11)29(4,5)6)26(28(41-22)35-15-14-31)43-45(12,13)30(7,8)9/h21-28H,14-17,31H2,1-13H3/t21-,22-,23-,24-,25+,26+,27+,28+/m1/s1 |
| InChIKey | KUJPYZPVLLDERH-MAILWWMQSA-N |
| XLogP | 3.64 |
| TPSA | 160.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 679.95 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|