C29H56O7Si — CID 167705010
[(2R,4S,5S)-6-ethyl-2-[(3S,4R,6S)-6-methoxy-4,5-dimethyl-2-[tri(propan-2-yl)silyloxymethyl]oxan-3-yl]oxy-4,5-dimethyloxan-3-yl] acetate (PubChem CID 167705010) has the molecular formula C29H56O7Si and a molecular weight of 544.85 g/mol. Its IUPAC name is [(2R,4S,5S)-6-ethyl-2-[(3S,4R,6S)-6-methoxy-4,5-dimethyl-2-[tri(propan-2-yl)silyloxymethyl]oxan-3-yl]oxy-4,5-dimethyloxan-3-yl] acetate.
| Compound Name | [(2R,4S,5S)-6-ethyl-2-[(3S,4R,6S)-6-methoxy-4,5-dimethyl-2-[tri(propan-2-yl)silyloxymethyl]oxan-3-yl]oxy-4,5-dimethyloxan-3-yl] acetate |
|---|---|
| PubChem CID | 167705010 |
| Molecular Formula | C29H56O7Si |
| Molecular Weight | 544.85 g/mol |
| Exact Mass | 544.38 |
| IUPAC Name | [(2R,4S,5S)-6-ethyl-2-[(3S,4R,6S)-6-methoxy-4,5-dimethyl-2-[tri(propan-2-yl)silyloxymethyl]oxan-3-yl]oxy-4,5-dimethyloxan-3-yl] acetate |
| SMILES | CCC1O[C@H](O[C@@H]2C(CO[Si](C(C)C)(C(C)C)C(C)C)O[C@H](OC)C(C)[C@H]2C)C(OC(C)=O)[C@@H](C)[C@@H]1C |
| InChI | InChI=1S/C29H56O7Si/c1-14-24-19(8)20(9)27(33-23(12)30)29(34-24)36-26-21(10)22(11)28(31-13)35-25(26)15-32-37(16(2)3,17(4)5)18(6)7/h16-22,24-29H,14-15H2,1-13H3/t19-,20-,21+,22?,24?,25?,26-,27?,28-,29+/m0/s1 |
| InChIKey | YYXSIQLRBAYIQN-GCSSWLBESA-N |
| XLogP | 6.55 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.85 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|