C26H54O7Si2 — CID 135017741
[(3S,4R,5R,6S)-2,4-dihydroxy-5-tri(propan-2-yl)silyloxy-6-[tri(propan-2-yl)silyloxymethyl]oxan-3-yl] acetate (PubChem CID 135017741) has the molecular formula C26H54O7Si2 and a molecular weight of 534.88 g/mol. Its IUPAC name is [(3S,4R,5R,6S)-2,4-dihydroxy-5-tri(propan-2-yl)silyloxy-6-[tri(propan-2-yl)silyloxymethyl]oxan-3-yl] acetate.
| Compound Name | [(3S,4R,5R,6S)-2,4-dihydroxy-5-tri(propan-2-yl)silyloxy-6-[tri(propan-2-yl)silyloxymethyl]oxan-3-yl] acetate |
|---|---|
| PubChem CID | 135017741 |
| Molecular Formula | C26H54O7Si2 |
| Molecular Weight | 534.88 g/mol |
| Exact Mass | 534.34 |
| IUPAC Name | [(3S,4R,5R,6S)-2,4-dihydroxy-5-tri(propan-2-yl)silyloxy-6-[tri(propan-2-yl)silyloxymethyl]oxan-3-yl] acetate |
| SMILES | CC(=O)O[C@@H]1C(O)O[C@@H](CO[Si](C(C)C)(C(C)C)C(C)C)[C@H](O[Si](C(C)C)(C(C)C)C(C)C)[C@@H]1O |
| InChI | InChI=1S/C26H54O7Si2/c1-15(2)34(16(3)4,17(5)6)30-14-22-24(23(28)25(26(29)32-22)31-21(13)27)33-35(18(7)8,19(9)10)20(11)12/h15-20,22-26,28-29H,14H2,1-13H3/t22-,23-,24-,25-,26?/m0/s1 |
| InChIKey | XFRHYKMEQAGHNO-RKLPTUIUSA-N |
| XLogP | 5.75 |
| TPSA | 94.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.88 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|