C24H35Cl3N4O8 — CID 123644013
[(2S,4S,5S,6R)-6-acetyl-5-[(2R,4S,5S,6S)-3-azido-6-ethyl-4,5-dimethyloxan-2-yl]oxy-4-methyl-2-(2,2,2-trichloroethanimidoyl)oxyoxan-3-yl] 4-oxopentanoate (PubChem CID 123644013) has the molecular formula C24H35Cl3N4O8 and a molecular weight of 613.92 g/mol. Its IUPAC name is [(2S,4S,5S,6R)-6-acetyl-5-[(2R,4S,5S,6S)-3-azido-6-ethyl-4,5-dimethyloxan-2-yl]oxy-4-methyl-2-(2,2,2-trichloroethanimidoyl)oxyoxan-3-yl] 4-oxopentanoate.
| Compound Name | [(2S,4S,5S,6R)-6-acetyl-5-[(2R,4S,5S,6S)-3-azido-6-ethyl-4,5-dimethyloxan-2-yl]oxy-4-methyl-2-(2,2,2-trichloroethanimidoyl)oxyoxan-3-yl] 4-oxopentanoate |
|---|---|
| PubChem CID | 123644013 |
| Molecular Formula | C24H35Cl3N4O8 |
| Molecular Weight | 613.92 g/mol |
| Exact Mass | 612.15 |
| IUPAC Name | [(2S,4S,5S,6R)-6-acetyl-5-[(2R,4S,5S,6S)-3-azido-6-ethyl-4,5-dimethyloxan-2-yl]oxy-4-methyl-2-(2,2,2-trichloroethanimidoyl)oxyoxan-3-yl] 4-oxopentanoate |
| SMILES | [H]/N=C(/O[C@@H]1O[C@@H](C(C)=O)[C@@H](O[C@H]2O[C@@H](CC)[C@@H](C)[C@H](C)C2N=[N+]=[N-])[C@H](C)C1OC(=O)CCC(C)=O)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C24H35Cl3N4O8/c1-7-15-11(3)12(4)17(30-31-29)21(35-15)37-18-13(5)19(36-16(34)9-8-10(2)32)22(38-20(18)14(6)33)39-23(28)24(25,26)27/h11-13,15,17-22,28H,7-9H2,1-6H3/b28-23+/t11-,12-,13-,15-,17?,18-,19?,20-,21+,22-/m0/s1 |
| InChIKey | UFMAQRQOTNMEIW-PDJWFTLXSA-N |
| XLogP | 5.05 |
| TPSA | 169.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.92 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|