C42H45N3O10 — CID 170219684
[6-(azidomethoxy)-5-benzoyloxy-4-[3,6-dimethyl-4,5-bis(phenylmethoxy)oxan-2-yl]oxy-2-methyloxan-3-yl] benzoate (PubChem CID 170219684) has the molecular formula C42H45N3O10 and a molecular weight of 751.83 g/mol. Its IUPAC name is [6-(azidomethoxy)-5-benzoyloxy-4-[3,6-dimethyl-4,5-bis(phenylmethoxy)oxan-2-yl]oxy-2-methyloxan-3-yl] benzoate.
| Compound Name | [6-(azidomethoxy)-5-benzoyloxy-4-[3,6-dimethyl-4,5-bis(phenylmethoxy)oxan-2-yl]oxy-2-methyloxan-3-yl] benzoate |
|---|---|
| PubChem CID | 170219684 |
| Molecular Formula | C42H45N3O10 |
| Molecular Weight | 751.83 g/mol |
| Exact Mass | 751.31 |
| IUPAC Name | [6-(azidomethoxy)-5-benzoyloxy-4-[3,6-dimethyl-4,5-bis(phenylmethoxy)oxan-2-yl]oxy-2-methyloxan-3-yl] benzoate |
| SMILES | CC1OC(OC2C(OC(=O)c3ccccc3)C(C)OC(OCN=[N+]=[N-])C2OC(=O)c2ccccc2)C(C)C(OCc2ccccc2)C1OCc1ccccc1 |
| InChI | InChI=1S/C42H45N3O10/c1-27-34(48-24-30-16-8-4-9-17-30)35(49-25-31-18-10-5-11-19-31)28(2)51-41(27)55-37-36(53-39(46)32-20-12-6-13-21-32)29(3)52-42(50-26-44-45-43)38(37)54-40(47)33-22-14-7-15-23-33/h4-23,27-29,34-38,41-42H,24-26H2,1-3H3 |
| InChIKey | AGRRNTGFJBMAPB-UHFFFAOYSA-N |
| XLogP | 7.40 |
| TPSA | 156.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 55 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 751.83 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|