C17H18ClF3N4O6S — CID 174018657
[(3R,6R)-3-acetyloxy-4-azido-6-[[5-chloro-2-(trifluoromethyl)-3-pyridinyl]sulfanyl]-5-methoxyoxan-2-yl]methyl acetate (PubChem CID 174018657) has the molecular formula C17H18ClF3N4O6S and a molecular weight of 498.87 g/mol. Its IUPAC name is [(3R,6R)-3-acetyloxy-4-azido-6-[[5-chloro-2-(trifluoromethyl)-3-pyridinyl]sulfanyl]-5-methoxyoxan-2-yl]methyl acetate.
| Compound Name | [(3R,6R)-3-acetyloxy-4-azido-6-[[5-chloro-2-(trifluoromethyl)-3-pyridinyl]sulfanyl]-5-methoxyoxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 174018657 |
| Molecular Formula | C17H18ClF3N4O6S |
| Molecular Weight | 498.87 g/mol |
| Exact Mass | 498.06 |
| IUPAC Name | [(3R,6R)-3-acetyloxy-4-azido-6-[[5-chloro-2-(trifluoromethyl)-3-pyridinyl]sulfanyl]-5-methoxyoxan-2-yl]methyl acetate |
| SMILES | COC1C(N=[N+]=[N-])[C@@H](OC(C)=O)C(COC(C)=O)O[C@@H]1Sc1cc(Cl)cnc1C(F)(F)F |
| InChI | InChI=1S/C17H18ClF3N4O6S/c1-7(26)29-6-10-13(30-8(2)27)12(24-25-22)14(28-3)16(31-10)32-11-4-9(18)5-23-15(11)17(19,20)21/h4-5,10,12-14,16H,6H2,1-3H3/t10?,12?,13-,14?,16+/m0/s1 |
| InChIKey | KPBSXEJOKLDNQI-IGXCMMJKSA-N |
| XLogP | 3.76 |
| TPSA | 132.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.87 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|