C13H19N5O7S — CID 164842768
[(3R,4S,6S)-3,5-diacetyloxy-4-azido-6-carbamimidoylsulfanyloxan-2-yl]methyl acetate (PubChem CID 164842768) has the molecular formula C13H19N5O7S and a molecular weight of 389.39 g/mol. Its IUPAC name is [(3R,4S,6S)-3,5-diacetyloxy-4-azido-6-carbamimidoylsulfanyloxan-2-yl]methyl acetate.
| Compound Name | [(3R,4S,6S)-3,5-diacetyloxy-4-azido-6-carbamimidoylsulfanyloxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 164842768 |
| Molecular Formula | C13H19N5O7S |
| Molecular Weight | 389.39 g/mol |
| Exact Mass | 389.10 |
| IUPAC Name | [(3R,4S,6S)-3,5-diacetyloxy-4-azido-6-carbamimidoylsulfanyloxan-2-yl]methyl acetate |
| SMILES | [H]/N=C(\N)S[C@@H]1OC(COC(C)=O)[C@H](OC(C)=O)[C@H](N=[N+]=[N-])C1OC(C)=O |
| InChI | InChI=1S/C13H19N5O7S/c1-5(19)22-4-8-10(23-6(2)20)9(17-18-16)11(24-7(3)21)12(25-8)26-13(14)15/h8-12H,4H2,1-3H3,(H3,14,15)/t8?,9-,10-,11?,12-/m0/s1 |
| InChIKey | FTTNUUMOBNAZPQ-MNALBRSASA-N |
| XLogP | 0.44 |
| TPSA | 186.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.39 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|