C29H44BrN3O14S2 — CID 161472907
(3,5-diacetyloxy-6-carbamimidoylsulfanyl-4-methyloxan-2-yl)methyl acetate;[3,5-diacetyloxy-6-(cyanomethylsulfanyl)-4-methyloxan-2-yl]methyl acetate;hydrobromide (PubChem CID 161472907) has the molecular formula C29H44BrN3O14S2 and a molecular weight of 802.72 g/mol. Its IUPAC name is (3,5-diacetyloxy-6-carbamimidoylsulfanyl-4-methyloxan-2-yl)methyl acetate;[3,5-diacetyloxy-6-(cyanomethylsulfanyl)-4-methyloxan-2-yl]methyl acetate;hydrobromide.
| Compound Name | (3,5-diacetyloxy-6-carbamimidoylsulfanyl-4-methyloxan-2-yl)methyl acetate;[3,5-diacetyloxy-6-(cyanomethylsulfanyl)-4-methyloxan-2-yl]methyl acetate;hydrobromide |
|---|---|
| PubChem CID | 161472907 |
| Molecular Formula | C29H44BrN3O14S2 |
| Molecular Weight | 802.72 g/mol |
| Exact Mass | 801.14 |
| IUPAC Name | (3,5-diacetyloxy-6-carbamimidoylsulfanyl-4-methyloxan-2-yl)methyl acetate;[3,5-diacetyloxy-6-(cyanomethylsulfanyl)-4-methyloxan-2-yl]methyl acetate;hydrobromide |
| SMILES | Br.CC(=O)OCC1OC(SCC#N)C(OC(C)=O)C(C)C1OC(C)=O.[H]/N=C(\N)SC1OC(COC(C)=O)C(OC(C)=O)C(C)C1OC(C)=O |
| InChI | InChI=1S/C15H21NO7S.C14H22N2O7S.BrH/c1-8-13(21-10(3)18)12(7-20-9(2)17)23-15(24-6-5-16)14(8)22-11(4)19;1-6-11(21-8(3)18)10(5-20-7(2)17)23-13(24-14(15)16)12(6)22-9(4)19;/h8,12-15H,6-7H2,1-4H3;6,10-13H,5H2,1-4H3,(H3,15,16);1H |
| InChIKey | ABHBNFUZZSEGCO-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 249.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 802.72 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|