C15H21NO7S — CID 59002366
[3,5-diacetyloxy-6-(cyanomethylsulfanyl)-4-methyloxan-2-yl]methyl acetate (PubChem CID 59002366) has the molecular formula C15H21NO7S and a molecular weight of 359.40 g/mol. Its IUPAC name is [3,5-diacetyloxy-6-(cyanomethylsulfanyl)-4-methyloxan-2-yl]methyl acetate.
| Compound Name | [3,5-diacetyloxy-6-(cyanomethylsulfanyl)-4-methyloxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 59002366 |
| Molecular Formula | C15H21NO7S |
| Molecular Weight | 359.40 g/mol |
| Exact Mass | 359.10 |
| IUPAC Name | [3,5-diacetyloxy-6-(cyanomethylsulfanyl)-4-methyloxan-2-yl]methyl acetate |
| SMILES | CC(=O)OCC1OC(SCC#N)C(OC(C)=O)C(C)C1OC(C)=O |
| InChI | InChI=1S/C15H21NO7S/c1-8-13(21-10(3)18)12(7-20-9(2)17)23-15(24-6-5-16)14(8)22-11(4)19/h8,12-15H,6-7H2,1-4H3 |
| InChIKey | HEKCYOIAONHEFS-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 111.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.40 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|