C27H42O9S — CID 102094225
[(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-(dicyclohexylmethylsulfanyl)oxan-2-yl]methyl acetate (PubChem CID 102094225) has the molecular formula C27H42O9S and a molecular weight of 542.69 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-(dicyclohexylmethylsulfanyl)oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-(dicyclohexylmethylsulfanyl)oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 102094225 |
| Molecular Formula | C27H42O9S |
| Molecular Weight | 542.69 g/mol |
| Exact Mass | 542.25 |
| IUPAC Name | [(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-(dicyclohexylmethylsulfanyl)oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](SC(C2CCCCC2)C2CCCCC2)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C27H42O9S/c1-16(28)32-15-22-23(33-17(2)29)24(34-18(3)30)25(35-19(4)31)27(36-22)37-26(20-11-7-5-8-12-20)21-13-9-6-10-14-21/h20-27H,5-15H2,1-4H3/t22-,23-,24+,25-,27+/m1/s1 |
| InChIKey | JRWLMPRKDSLJSZ-NUPXYHBHSA-N |
| XLogP | 4.33 |
| TPSA | 114.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.69 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|