C19H24NO9+ — CID 169439502
ethyl 1-[(2S,3R,4R,5R)-3,4-diacetyloxy-5-(acetyloxymethyl)oxolan-2-yl]pyridin-1-ium-3-carboxylate (PubChem CID 169439502) has the molecular formula C19H24NO9+ and a molecular weight of 410.40 g/mol. Its IUPAC name is ethyl 1-[(2S,3R,4R,5R)-3,4-diacetyloxy-5-(acetyloxymethyl)oxolan-2-yl]pyridin-1-ium-3-carboxylate.
| Compound Name | ethyl 1-[(2S,3R,4R,5R)-3,4-diacetyloxy-5-(acetyloxymethyl)oxolan-2-yl]pyridin-1-ium-3-carboxylate |
|---|---|
| PubChem CID | 169439502 |
| Molecular Formula | C19H24NO9+ |
| Molecular Weight | 410.40 g/mol |
| Exact Mass | 410.14 |
| IUPAC Name | ethyl 1-[(2S,3R,4R,5R)-3,4-diacetyloxy-5-(acetyloxymethyl)oxolan-2-yl]pyridin-1-ium-3-carboxylate |
| SMILES | CCOC(=O)c1ccc[n+]([C@H]2O[C@H](COC(C)=O)[C@@H](OC(C)=O)[C@H]2OC(C)=O)c1 |
| InChI | InChI=1S/C19H24NO9/c1-5-25-19(24)14-7-6-8-20(9-14)18-17(28-13(4)23)16(27-12(3)22)15(29-18)10-26-11(2)21/h6-9,15-18H,5,10H2,1-4H3/q+1/t15-,16-,17-,18+/m1/s1 |
| InChIKey | YMUIBEWJWTUJQV-TVFCKZIOSA-N |
| XLogP | 0.47 |
| TPSA | 118.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.40 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|