C20H25BrN2O9S — CID 171375969
1-[3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]pyridin-1-ium-3-carboximidothioate;hydrobromide (PubChem CID 171375969) has the molecular formula C20H25BrN2O9S and a molecular weight of 549.40 g/mol. Its IUPAC name is 1-[3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]pyridin-1-ium-3-carboximidothioate;hydrobromide.
| Compound Name | 1-[3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]pyridin-1-ium-3-carboximidothioate;hydrobromide |
|---|---|
| PubChem CID | 171375969 |
| Molecular Formula | C20H25BrN2O9S |
| Molecular Weight | 549.40 g/mol |
| Exact Mass | 548.05 |
| IUPAC Name | 1-[3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]pyridin-1-ium-3-carboximidothioate;hydrobromide |
| SMILES | Br.[H]/N=C(\[S-])c1ccc[n+](C2OC(COC(C)=O)C(OC(C)=O)C(OC(C)=O)C2OC(C)=O)c1 |
| InChI | InChI=1S/C20H24N2O9S.BrH/c1-10(23)27-9-15-16(28-11(2)24)17(29-12(3)25)18(30-13(4)26)20(31-15)22-7-5-6-14(8-22)19(21)32;/h5-8,15-18,20H,9H2,1-4H3,(H-,21,32);1H |
| InChIKey | GOGLDPGICWWAKY-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 142.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.40 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|