C21H24ClN8O6P — CID 54770423
ethyl (2S)-2-[[[(2R,3R,5S)-3-azido-5-(6-chloropurin-9-yl)oxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate (PubChem CID 54770423) has the molecular formula C21H24ClN8O6P and a molecular weight of 550.90 g/mol. Its IUPAC name is ethyl (2S)-2-[[[(2R,3R,5S)-3-azido-5-(6-chloropurin-9-yl)oxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate.
| Compound Name | ethyl (2S)-2-[[[(2R,3R,5S)-3-azido-5-(6-chloropurin-9-yl)oxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 54770423 |
| Molecular Formula | C21H24ClN8O6P |
| Molecular Weight | 550.90 g/mol |
| Exact Mass | 550.12 |
| IUPAC Name | ethyl (2S)-2-[[[(2R,3R,5S)-3-azido-5-(6-chloropurin-9-yl)oxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
| SMILES | CCOC(=O)[C@H](C)NP(=O)(OC[C@@H]1O[C@H](n2cnc3c(Cl)ncnc32)C[C@H]1N=[N+]=[N-])Oc1ccccc1 |
| InChI | InChI=1S/C21H24ClN8O6P/c1-3-33-21(31)13(2)28-37(32,36-14-7-5-4-6-8-14)34-10-16-15(27-29-23)9-17(35-16)30-12-26-18-19(22)24-11-25-20(18)30/h4-8,11-13,15-17H,3,9-10H2,1-2H3,(H,28,32)/t13-,15+,16-,17-,37?/m0/s1 |
| InChIKey | IGPSGTUKMHWZDX-FOENAXRWSA-N |
| XLogP | 4.19 |
| TPSA | 175.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.90 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|