C31H40ClFN5O7P — CID 155624171
[(1S,2R,4S)-4-(2-amino-6-oxo-1H-purin-9-yl)-2-[[(4R)-4-(5-chloro-2-fluorophenyl)-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl]oxymethyl]-3-methylidenecyclopentyl] decanoate (PubChem CID 155624171) has the molecular formula C31H40ClFN5O7P and a molecular weight of 680.11 g/mol. Its IUPAC name is [(1S,2R,4S)-4-(2-amino-6-oxo-1H-purin-9-yl)-2-[[(4R)-4-(5-chloro-2-fluorophenyl)-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl]oxymethyl]-3-methylidenecyclopentyl] decanoate.
| Compound Name | [(1S,2R,4S)-4-(2-amino-6-oxo-1H-purin-9-yl)-2-[[(4R)-4-(5-chloro-2-fluorophenyl)-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl]oxymethyl]-3-methylidenecyclopentyl] decanoate |
|---|---|
| PubChem CID | 155624171 |
| Molecular Formula | C31H40ClFN5O7P |
| Molecular Weight | 680.11 g/mol |
| Exact Mass | 679.23 |
| IUPAC Name | [(1S,2R,4S)-4-(2-amino-6-oxo-1H-purin-9-yl)-2-[[(4R)-4-(5-chloro-2-fluorophenyl)-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl]oxymethyl]-3-methylidenecyclopentyl] decanoate |
| SMILES | C=C1[C@H](COP2(=O)OCC[C@H](c3cc(Cl)ccc3F)O2)[C@@H](OC(=O)CCCCCCCCC)C[C@@H]1n1cnc2c(=O)[nH]c(N)nc21 |
| InChI | InChI=1S/C31H40ClFN5O7P/c1-3-4-5-6-7-8-9-10-27(39)44-26-16-24(38-18-35-28-29(38)36-31(34)37-30(28)40)19(2)22(26)17-43-46(41)42-14-13-25(45-46)21-15-20(32)11-12-23(21)33/h11-12,15,18,22,24-26H,2-10,13-14,16-17H2,1H3,(H3,34,36,37,40)/t22-,24-,25+,26-,46?/m0/s1 |
| InChIKey | YZEANIIJMAUTDF-FKUGIPNFSA-N |
| XLogP | 6.97 |
| TPSA | 160.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 46 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.11 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|