C21H22ClFN5O6P — CID 155174013
2-amino-9-[(1S,3R,4S)-3-[[(2S,4R)-4-(2-chloro-5-fluorophenyl)-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl]oxymethyl]-4-hydroxy-2-methylidenecyclopentyl]-1H-purin-6-one (PubChem CID 155174013) has the molecular formula C21H22ClFN5O6P and a molecular weight of 525.86 g/mol. Its IUPAC name is 2-amino-9-[(1S,3R,4S)-3-[[(2S,4R)-4-(2-chloro-5-fluorophenyl)-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl]oxymethyl]-4-hydroxy-2-methylidenecyclopentyl]-1H-purin-6-one.
| Compound Name | 2-amino-9-[(1S,3R,4S)-3-[[(2S,4R)-4-(2-chloro-5-fluorophenyl)-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl]oxymethyl]-4-hydroxy-2-methylidenecyclopentyl]-1H-purin-6-one |
|---|---|
| PubChem CID | 155174013 |
| Molecular Formula | C21H22ClFN5O6P |
| Molecular Weight | 525.86 g/mol |
| Exact Mass | 525.10 |
| IUPAC Name | 2-amino-9-[(1S,3R,4S)-3-[[(2S,4R)-4-(2-chloro-5-fluorophenyl)-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl]oxymethyl]-4-hydroxy-2-methylidenecyclopentyl]-1H-purin-6-one |
| SMILES | C=C1[C@H](CO[P@]2(=O)OCC[C@H](c3cc(F)ccc3Cl)O2)[C@@H](O)C[C@@H]1n1cnc2c(=O)[nH]c(N)nc21 |
| InChI | InChI=1S/C21H22ClFN5O6P/c1-10-13(16(29)7-15(10)28-9-25-18-19(28)26-21(24)27-20(18)30)8-33-35(31)32-5-4-17(34-35)12-6-11(23)2-3-14(12)22/h2-3,6,9,13,15-17,29H,1,4-5,7-8H2,(H3,24,26,27,30)/t13-,15-,16-,17+,35-/m0/s1 |
| InChIKey | SFAXYYRSLPXSGI-HZPNABFKSA-N |
| XLogP | 3.28 |
| TPSA | 154.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.86 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|