C25H28ClFN5O8P — CID 155174053
[(1S,2R,4S)-4-(2-amino-6-oxo-1H-purin-9-yl)-2-[[(2S,4R)-4-(5-chloro-2-fluorophenyl)-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl]oxymethyl]-3-methylidenecyclopentyl] propan-2-yl carbonate (PubChem CID 155174053) has the molecular formula C25H28ClFN5O8P and a molecular weight of 611.95 g/mol. Its IUPAC name is [(1S,2R,4S)-4-(2-amino-6-oxo-1H-purin-9-yl)-2-[[(2S,4R)-4-(5-chloro-2-fluorophenyl)-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl]oxymethyl]-3-methylidenecyclopentyl] propan-2-yl carbonate.
| Compound Name | [(1S,2R,4S)-4-(2-amino-6-oxo-1H-purin-9-yl)-2-[[(2S,4R)-4-(5-chloro-2-fluorophenyl)-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl]oxymethyl]-3-methylidenecyclopentyl] propan-2-yl carbonate |
|---|---|
| PubChem CID | 155174053 |
| Molecular Formula | C25H28ClFN5O8P |
| Molecular Weight | 611.95 g/mol |
| Exact Mass | 611.13 |
| IUPAC Name | [(1S,2R,4S)-4-(2-amino-6-oxo-1H-purin-9-yl)-2-[[(2S,4R)-4-(5-chloro-2-fluorophenyl)-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl]oxymethyl]-3-methylidenecyclopentyl] propan-2-yl carbonate |
| SMILES | C=C1[C@H](CO[P@]2(=O)OCC[C@H](c3cc(Cl)ccc3F)O2)[C@@H](OC(=O)OC(C)C)C[C@@H]1n1cnc2c(=O)[nH]c(N)nc21 |
| InChI | InChI=1S/C25H28ClFN5O8P/c1-12(2)38-25(34)39-20-9-18(32-11-29-21-22(32)30-24(28)31-23(21)33)13(3)16(20)10-37-41(35)36-7-6-19(40-41)15-8-14(26)4-5-17(15)27/h4-5,8,11-12,16,18-20H,3,6-7,9-10H2,1-2H3,(H3,28,30,31,33)/t16-,18-,19+,20-,41-/m0/s1 |
| InChIKey | DOIJZZJQTQVAHW-NVJPHASPSA-N |
| XLogP | 4.84 |
| TPSA | 169.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.95 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|