C31H45N7O8 — CID 136811073
[(2S,3R,4R,5S)-3,4-bis(cyclohexylcarbamoyloxy)-5-(6-oxo-1H-purin-9-yl)oxolan-2-yl]methyl N-cyclohexylcarbamate (PubChem CID 136811073) has the molecular formula C31H45N7O8 and a molecular weight of 643.74 g/mol. Its IUPAC name is [(2S,3R,4R,5S)-3,4-bis(cyclohexylcarbamoyloxy)-5-(6-oxo-1H-purin-9-yl)oxolan-2-yl]methyl N-cyclohexylcarbamate.
| Compound Name | [(2S,3R,4R,5S)-3,4-bis(cyclohexylcarbamoyloxy)-5-(6-oxo-1H-purin-9-yl)oxolan-2-yl]methyl N-cyclohexylcarbamate |
|---|---|
| PubChem CID | 136811073 |
| Molecular Formula | C31H45N7O8 |
| Molecular Weight | 643.74 g/mol |
| Exact Mass | 643.33 |
| IUPAC Name | [(2S,3R,4R,5S)-3,4-bis(cyclohexylcarbamoyloxy)-5-(6-oxo-1H-purin-9-yl)oxolan-2-yl]methyl N-cyclohexylcarbamate |
| SMILES | O=C(NC1CCCCC1)OC[C@@H]1O[C@H](n2cnc3c(=O)[nH]cnc32)[C@H](OC(=O)NC2CCCCC2)[C@@H]1OC(=O)NC1CCCCC1 |
| InChI | InChI=1S/C31H45N7O8/c39-27-23-26(32-17-33-27)38(18-34-23)28-25(46-31(42)37-21-14-8-3-9-15-21)24(45-30(41)36-20-12-6-2-7-13-20)22(44-28)16-43-29(40)35-19-10-4-1-5-11-19/h17-22,24-25,28H,1-16H2,(H,35,40)(H,36,41)(H,37,42)(H,32,33,39)/t22-,24+,25+,28-/m0/s1 |
| InChIKey | XLQBBKKIFIIJJI-KKMWARJNSA-N |
| XLogP | 3.93 |
| TPSA | 187.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.74 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|