C25H23BClN5O6P — CID 88580409
CID 88580409 (PubChem CID 88580409) has the molecular formula C25H23BClN5O6P and a molecular weight of 566.73 g/mol.
| Compound Name | CID 88580409 |
|---|---|
| PubChem CID | 88580409 |
| Molecular Formula | C25H23BClN5O6P |
| Molecular Weight | 566.73 g/mol |
| Exact Mass | 566.12 |
| IUPAC Name | — |
| SMILES | C[C@H](PN[B]O)[C@H]1O[C@@H](n2cnc3c(Cl)ncnc32)[C@H](OC(=O)c2ccccc2)[C@@H]1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C25H23BClN5O6P/c1-14(39-31-26-35)18-19(37-24(33)15-8-4-2-5-9-15)20(38-25(34)16-10-6-3-7-11-16)23(36-18)32-13-30-17-21(27)28-12-29-22(17)32/h2-14,18-20,23,31,35,39H,1H3/t14-,18+,19+,20+,23+/m0/s1 |
| InChIKey | BUZPYSJFCDQXTG-VUOJXHKESA-N |
| XLogP | 2.93 |
| TPSA | 137.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.73 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|