C32H24ClN5O9 — CID 87156595
[(1S)-1-[(2R,3R,4R,5R)-3,4-dibenzoyloxy-5-(6-chloropurin-9-yl)oxolan-2-yl]ethyl] 4-nitrobenzoate (PubChem CID 87156595) has the molecular formula C32H24ClN5O9 and a molecular weight of 658.02 g/mol. Its IUPAC name is [(1S)-1-[(2R,3R,4R,5R)-3,4-dibenzoyloxy-5-(6-chloropurin-9-yl)oxolan-2-yl]ethyl] 4-nitrobenzoate.
| Compound Name | [(1S)-1-[(2R,3R,4R,5R)-3,4-dibenzoyloxy-5-(6-chloropurin-9-yl)oxolan-2-yl]ethyl] 4-nitrobenzoate |
|---|---|
| PubChem CID | 87156595 |
| Molecular Formula | C32H24ClN5O9 |
| Molecular Weight | 658.02 g/mol |
| Exact Mass | 657.13 |
| IUPAC Name | [(1S)-1-[(2R,3R,4R,5R)-3,4-dibenzoyloxy-5-(6-chloropurin-9-yl)oxolan-2-yl]ethyl] 4-nitrobenzoate |
| SMILES | C[C@H](OC(=O)c1ccc([N+](=O)[O-])cc1)[C@H]1O[C@@H](n2cnc3c(Cl)ncnc32)[C@H](OC(=O)c2ccccc2)[C@@H]1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C32H24ClN5O9/c1-18(44-30(39)21-12-14-22(15-13-21)38(42)43)24-25(46-31(40)19-8-4-2-5-9-19)26(47-32(41)20-10-6-3-7-11-20)29(45-24)37-17-36-23-27(33)34-16-35-28(23)37/h2-18,24-26,29H,1H3/t18-,24+,25+,26+,29+/m0/s1 |
| InChIKey | ITRJTOAPVKEZPW-SAGYWUAHSA-N |
| XLogP | 4.98 |
| TPSA | 174.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.02 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|