C22H24IN3O9S — CID 87409133
[(2R,3S,4R,5R)-4-acetyloxy-5-[4-amino-5-[(E)-2-iodoethenyl]-2-oxopyrimidin-1-yl]-3-(4-methylphenyl)sulfonyloxyoxolan-2-yl]methyl acetate (PubChem CID 87409133) has the molecular formula C22H24IN3O9S and a molecular weight of 633.42 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-4-acetyloxy-5-[4-amino-5-[(E)-2-iodoethenyl]-2-oxopyrimidin-1-yl]-3-(4-methylphenyl)sulfonyloxyoxolan-2-yl]methyl acetate.
| Compound Name | [(2R,3S,4R,5R)-4-acetyloxy-5-[4-amino-5-[(E)-2-iodoethenyl]-2-oxopyrimidin-1-yl]-3-(4-methylphenyl)sulfonyloxyoxolan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 87409133 |
| Molecular Formula | C22H24IN3O9S |
| Molecular Weight | 633.42 g/mol |
| Exact Mass | 633.03 |
| IUPAC Name | [(2R,3S,4R,5R)-4-acetyloxy-5-[4-amino-5-[(E)-2-iodoethenyl]-2-oxopyrimidin-1-yl]-3-(4-methylphenyl)sulfonyloxyoxolan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](n2cc(/C=C/I)c(N)nc2=O)[C@H](OC(C)=O)[C@H]1OS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C22H24IN3O9S/c1-12-4-6-16(7-5-12)36(30,31)35-18-17(11-32-13(2)27)34-21(19(18)33-14(3)28)26-10-15(8-9-23)20(24)25-22(26)29/h4-10,17-19,21H,11H2,1-3H3,(H2,24,25,29)/b9-8+/t17-,18+,19-,21-/m1/s1 |
| InChIKey | LLDURSDBCFDSLN-SWQIVCBNSA-N |
| XLogP | 1.71 |
| TPSA | 166.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.42 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|